C21H23N3O — CID 10449501
1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one (PubChem CID 10449501) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one.
| Compound Name | 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 10449501 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cnc2c(N)cccc2c1Nc1c(C)cccc1C |
| InChI | InChI=1S/C21H23N3O/c1-4-7-18(25)16-12-23-21-15(10-6-11-17(21)22)20(16)24-19-13(2)8-5-9-14(19)3/h5-6,8-12H,4,7,22H2,1-3H3,(H,23,24) |
| InChIKey | CMEWHSPKEVTVRY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|