About 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one
1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one (PubChem CID 10449501) has the molecular formula C21H23N3O
and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one.
Molecular Properties
| Compound Name | 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one |
| PubChem CID | 10449501 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cnc2c(N)cccc2c1Nc1c(C)cccc1C |
| InChI | InChI=1S/C21H23N3O/c1-4-7-18(25)16-12-23-21-15(10-6-11-17(21)22)20(16)24-19-13(2)8-5-9-14(19)3/h5-6,8-12H,4,7,22H2,1-3H3,(H,23,24) |
| InChIKey | CMEWHSPKEVTVRY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one?
The IUPAC name of 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one (CID 10449501) is 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one.
What is the SMILES notation for 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one?
The canonical SMILES for 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one is CCCC(=O)c1cnc2c(N)cccc2c1Nc1c(C)cccc1C.
What is the InChIKey of 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one?
The InChIKey is CMEWHSPKEVTVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O/c1-4-7-18(25)16-12-23-21-15(10-6-11-17(21)22)20(16)24-19-13(2)8-5-9-14(19)3/h5-6,8-12H,4,7,22H2,1-3H3,(H,23,24).
What are the key properties of 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one?
1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one has a molecular weight of 333.44 g/mol, XLogP of 5.16, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[8-amino-4-(2,6-dimethylanilino)quinolin-3-yl]butan-1-one is sourced from PubChem (CID 10449501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).