C24H27FN2O5 — CID 142628370
3-butanoyl-4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]-1H-quinolin-2-one (PubChem CID 142628370) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-butanoyl-4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]-1H-quinolin-2-one.
| Compound Name | 3-butanoyl-4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142628370 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-butanoyl-4-(4-fluoro-2-methylanilino)-8-[2-(2-hydroxyethoxy)ethoxy]-1H-quinolin-2-one |
| SMILES | CCCC(=O)c1c(Nc2ccc(F)cc2C)c2cccc(OCCOCCO)c2[nH]c1=O |
| InChI | InChI=1S/C24H27FN2O5/c1-3-5-19(29)21-23(26-18-9-8-16(25)14-15(18)2)17-6-4-7-20(22(17)27-24(21)30)32-13-12-31-11-10-28/h4,6-9,14,28H,3,5,10-13H2,1-2H3,(H2,26,27,30) |
| InChIKey | HYOJZKUDIVWKHO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|