C22H24N2O2 — CID 57023800
1-[4-(4-methoxy-2-methylanilino)-6-methylquinolin-3-yl]butan-1-one (PubChem CID 57023800) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[4-(4-methoxy-2-methylanilino)-6-methylquinolin-3-yl]butan-1-one.
| Compound Name | 1-[4-(4-methoxy-2-methylanilino)-6-methylquinolin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 57023800 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[4-(4-methoxy-2-methylanilino)-6-methylquinolin-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cnc2ccc(C)cc2c1Nc1ccc(OC)cc1C |
| InChI | InChI=1S/C22H24N2O2/c1-5-6-21(25)18-13-23-20-9-7-14(2)11-17(20)22(18)24-19-10-8-16(26-4)12-15(19)3/h7-13H,5-6H2,1-4H3,(H,23,24) |
| InChIKey | ODZDDGMSXIWHSD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |