C22H23N3OS — CID 53001611
[4-(2,6-dimethylanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 53001611) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is [4-(2,6-dimethylanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [4-(2,6-dimethylanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53001611 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [4-(2,6-dimethylanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | Cc1cccc(C)c1Nc1c(C(=O)N2CCSCC2)cnc2ccccc12 |
| InChI | InChI=1S/C22H23N3OS/c1-15-6-5-7-16(2)20(15)24-21-17-8-3-4-9-19(17)23-14-18(21)22(26)25-10-12-27-13-11-25/h3-9,14H,10-13H2,1-2H3,(H,23,24) |
| InChIKey | ALWHGVBEPPBGJW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |