C16H17N3OS — CID 119062800
(4-methyl-2-phenylpyrimidin-5-yl)-thiomorpholin-4-ylmethanone (PubChem CID 119062800) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is (4-methyl-2-phenylpyrimidin-5-yl)-thiomorpholin-4-ylmethanone.
| Compound Name | (4-methyl-2-phenylpyrimidin-5-yl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 119062800 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (4-methyl-2-phenylpyrimidin-5-yl)-thiomorpholin-4-ylmethanone |
| SMILES | Cc1nc(-c2ccccc2)ncc1C(=O)N1CCSCC1 |
| InChI | InChI=1S/C16H17N3OS/c1-12-14(16(20)19-7-9-21-10-8-19)11-17-15(18-12)13-5-3-2-4-6-13/h2-6,11H,7-10H2,1H3 |
| InChIKey | PBUGWGAEYXDFMD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |