C29H28N4O — CID 100753052
(4-benzhydrylpiperazin-1-yl)-(4-methyl-2-phenylpyrimidin-5-yl)methanone (PubChem CID 100753052) has the molecular formula C29H28N4O and a molecular weight of 448.57 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-(4-methyl-2-phenylpyrimidin-5-yl)methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-(4-methyl-2-phenylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 100753052 |
| Molecular Formula | C29H28N4O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-(4-methyl-2-phenylpyrimidin-5-yl)methanone |
| SMILES | Cc1nc(-c2ccccc2)ncc1C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H28N4O/c1-22-26(21-30-28(31-22)25-15-9-4-10-16-25)29(34)33-19-17-32(18-20-33)27(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-16,21,27H,17-20H2,1H3 |
| InChIKey | HJXQNROTDIUTDF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |