C17H19N3O2S — CID 1474606
ethyl 2-phenyl-4-thiomorpholin-4-ylpyrimidine-5-carboxylate (PubChem CID 1474606) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is ethyl 2-phenyl-4-thiomorpholin-4-ylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-phenyl-4-thiomorpholin-4-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1474606 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethyl 2-phenyl-4-thiomorpholin-4-ylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2)nc1N1CCSCC1 |
| InChI | InChI=1S/C17H19N3O2S/c1-2-22-17(21)14-12-18-15(13-6-4-3-5-7-13)19-16(14)20-8-10-23-11-9-20/h3-7,12H,2,8-11H2,1H3 |
| InChIKey | IQJABAILEOBESO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |