C27H27N5O2 — CID 108776903
ethyl 2-(3-methylphenyl)-4-(4-quinolin-2-ylpiperazin-1-yl)pyrimidine-5-carboxylate (PubChem CID 108776903) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is ethyl 2-(3-methylphenyl)-4-(4-quinolin-2-ylpiperazin-1-yl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3-methylphenyl)-4-(4-quinolin-2-ylpiperazin-1-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 108776903 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | ethyl 2-(3-methylphenyl)-4-(4-quinolin-2-ylpiperazin-1-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2cccc(C)c2)nc1N1CCN(c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C27H27N5O2/c1-3-34-27(33)22-18-28-25(21-9-6-7-19(2)17-21)30-26(22)32-15-13-31(14-16-32)24-12-11-20-8-4-5-10-23(20)29-24/h4-12,17-18H,3,13-16H2,1-2H3 |
| InChIKey | NPLHPLAEOOKZLJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |