C26H22N6O2 — CID 108778745
ethyl 4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-2-phenylpyrimidine-5-carboxylate (PubChem CID 108778745) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is ethyl 4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-2-phenylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 108778745 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | ethyl 4-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-2-phenylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2)nc1Nc1cc(C)nn1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H22N6O2/c1-3-34-26(33)20-16-27-24(19-10-5-4-6-11-19)30-25(20)29-23-15-17(2)31-32(23)22-14-13-18-9-7-8-12-21(18)28-22/h4-16H,3H2,1-2H3,(H,27,29,30) |
| InChIKey | BVTWJXQAFGWBDP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |