C22H24N6O2 — CID 108772879
ethyl 2-methyl-4-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]pyrimidine-5-carboxylate (PubChem CID 108772879) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 2-methyl-4-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methyl-4-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 108772879 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | ethyl 2-methyl-4-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C)nc1N1CCN(c2ccc(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C22H24N6O2/c1-3-30-22(29)18-15-23-16(2)24-21(18)28-13-11-27(12-14-28)20-10-9-19(25-26-20)17-7-5-4-6-8-17/h4-10,15H,3,11-14H2,1-2H3 |
| InChIKey | VNHPTCAVWZVOQG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |