C27H32N4O4 — CID 108753628
[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 108753628) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is [4-(6-phenylpyridazin-3-yl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [4-(6-phenylpyridazin-3-yl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 108753628 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [4-(6-phenylpyridazin-3-yl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCN(c3ccc(-c4ccccc4)nn3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H32N4O4/c1-4-33-23-18-21(19-24(34-5-2)26(23)35-6-3)27(32)31-16-14-30(15-17-31)25-13-12-22(28-29-25)20-10-8-7-9-11-20/h7-13,18-19H,4-6,14-17H2,1-3H3 |
| InChIKey | PUJREORURIBSDJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |