C16H18N4O2 — CID 82167521
2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]acetic acid (PubChem CID 82167521) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 82167521 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2ccc(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C16H18N4O2/c21-16(22)12-19-8-10-20(11-9-19)15-7-6-14(17-18-15)13-4-2-1-3-5-13/h1-7H,8-12H2,(H,21,22) |
| InChIKey | ACBGYYDZZBKZRA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |