C20H17F2N3OS — CID 53001564
[6-fluoro-4-(3-fluoroanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 53001564) has the molecular formula C20H17F2N3OS and a molecular weight of 385.44 g/mol. Its IUPAC name is [6-fluoro-4-(3-fluoroanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [6-fluoro-4-(3-fluoroanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53001564 |
| Molecular Formula | C20H17F2N3OS |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [6-fluoro-4-(3-fluoroanilino)quinolin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1cnc2ccc(F)cc2c1Nc1cccc(F)c1)N1CCSCC1 |
| InChI | InChI=1S/C20H17F2N3OS/c21-13-2-1-3-15(10-13)24-19-16-11-14(22)4-5-18(16)23-12-17(19)20(26)25-6-8-27-9-7-25/h1-5,10-12H,6-9H2,(H,23,24) |
| InChIKey | QGCUWDMKFVRHHX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |