C21H19BrFN3OS — CID 71825043
[4-[(3-bromophenyl)methylamino]-6-fluoroquinolin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 71825043) has the molecular formula C21H19BrFN3OS and a molecular weight of 460.37 g/mol. Its IUPAC name is [4-[(3-bromophenyl)methylamino]-6-fluoroquinolin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [4-[(3-bromophenyl)methylamino]-6-fluoroquinolin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 71825043 |
| Molecular Formula | C21H19BrFN3OS |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | [4-[(3-bromophenyl)methylamino]-6-fluoroquinolin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1cnc2ccc(F)cc2c1NCc1cccc(Br)c1)N1CCSCC1 |
| InChI | InChI=1S/C21H19BrFN3OS/c22-15-3-1-2-14(10-15)12-25-20-17-11-16(23)4-5-19(17)24-13-18(20)21(27)26-6-8-28-9-7-26/h1-5,10-11,13H,6-9,12H2,(H,24,25) |
| InChIKey | RBGVVVLZWXPOTD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |