C23H25N3O2 — CID 25072332
[8-(hydroxymethyl)-4-(2-methylanilino)quinolin-3-yl]-piperidin-1-ylmethanone (PubChem CID 25072332) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is [8-(hydroxymethyl)-4-(2-methylanilino)quinolin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [8-(hydroxymethyl)-4-(2-methylanilino)quinolin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 25072332 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [8-(hydroxymethyl)-4-(2-methylanilino)quinolin-3-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccccc1Nc1c(C(=O)N2CCCCC2)cnc2c(CO)cccc12 |
| InChI | InChI=1S/C23H25N3O2/c1-16-8-3-4-11-20(16)25-22-18-10-7-9-17(15-27)21(18)24-14-19(22)23(28)26-12-5-2-6-13-26/h3-4,7-11,14,27H,2,5-6,12-13,15H2,1H3,(H,24,25) |
| InChIKey | MUEQDAHGZZKCRM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |