C19H19N3O2 — CID 53132045
methyl 4-(2-ethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate (PubChem CID 53132045) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is methyl 4-(2-ethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate.
| Compound Name | methyl 4-(2-ethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 53132045 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | methyl 4-(2-ethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
| SMILES | CCc1ccccc1Nc1c(C(=O)OC)cnc2nc(C)ccc12 |
| InChI | InChI=1S/C19H19N3O2/c1-4-13-7-5-6-8-16(13)22-17-14-10-9-12(2)21-18(14)20-11-15(17)19(23)24-3/h5-11H,4H2,1-3H3,(H,20,21,22) |
| InChIKey | NEOZCDYWBSOKFU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |