C19H19N3O2 — CID 50836366
propyl 4-anilino-7-methyl-1,8-naphthyridine-3-carboxylate (PubChem CID 50836366) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is propyl 4-anilino-7-methyl-1,8-naphthyridine-3-carboxylate.
| Compound Name | propyl 4-anilino-7-methyl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 50836366 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | propyl 4-anilino-7-methyl-1,8-naphthyridine-3-carboxylate |
| SMILES | CCCOC(=O)c1cnc2nc(C)ccc2c1Nc1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c1-3-11-24-19(23)16-12-20-18-15(10-9-13(2)21-18)17(16)22-14-7-5-4-6-8-14/h4-10,12H,3,11H2,1-2H3,(H,20,21,22) |
| InChIKey | LCJYVYSVIMUTHU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |