C20H21N3O3 — CID 50836500
propyl 4-(2-hydroxy-4-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate (PubChem CID 50836500) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is propyl 4-(2-hydroxy-4-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate.
| Compound Name | propyl 4-(2-hydroxy-4-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 50836500 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | propyl 4-(2-hydroxy-4-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
| SMILES | CCCOC(=O)c1cnc2nc(C)ccc2c1Nc1ccc(C)cc1O |
| InChI | InChI=1S/C20H21N3O3/c1-4-9-26-20(25)15-11-21-19-14(7-6-13(3)22-19)18(15)23-16-8-5-12(2)10-17(16)24/h5-8,10-11,24H,4,9H2,1-3H3,(H,21,22,23) |
| InChIKey | QNSYICDSCXCJKG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|