C20H18N4O2 — CID 50836623
propyl 4-(3-cyanoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate (PubChem CID 50836623) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is propyl 4-(3-cyanoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate.
| Compound Name | propyl 4-(3-cyanoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 50836623 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | propyl 4-(3-cyanoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
| SMILES | CCCOC(=O)c1cnc2nc(C)ccc2c1Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H18N4O2/c1-3-9-26-20(25)17-12-22-19-16(8-7-13(2)23-19)18(17)24-15-6-4-5-14(10-15)11-21/h4-8,10,12H,3,9H2,1-2H3,(H,22,23,24) |
| InChIKey | KBVMMDGWSWHDHK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |