C17H14IN3O2 — CID 53132018
methyl 4-(2-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate (PubChem CID 53132018) has the molecular formula C17H14IN3O2 and a molecular weight of 419.22 g/mol. Its IUPAC name is methyl 4-(2-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate.
| Compound Name | methyl 4-(2-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 53132018 |
| Molecular Formula | C17H14IN3O2 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | methyl 4-(2-iodoanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc2nc(C)ccc2c1Nc1ccccc1I |
| InChI | InChI=1S/C17H14IN3O2/c1-10-7-8-11-15(21-14-6-4-3-5-13(14)18)12(17(22)23-2)9-19-16(11)20-10/h3-9H,1-2H3,(H,19,20,21) |
| InChIKey | YMNZMIOOTYOYEF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|