C19H18ClN3O4 — CID 22694130
4-[4-(dimethylamino)anilino]quinoline-3,6-dicarboxylic acid;hydrochloride (PubChem CID 22694130) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 4-[4-(dimethylamino)anilino]quinoline-3,6-dicarboxylic acid;hydrochloride.
| Compound Name | 4-[4-(dimethylamino)anilino]quinoline-3,6-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 22694130 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-[4-(dimethylamino)anilino]quinoline-3,6-dicarboxylic acid;hydrochloride |
| SMILES | CN(C)c1ccc(Nc2c(C(=O)O)cnc3ccc(C(=O)O)cc23)cc1.Cl |
| InChI | InChI=1S/C19H17N3O4.ClH/c1-22(2)13-6-4-12(5-7-13)21-17-14-9-11(18(23)24)3-8-16(14)20-10-15(17)19(25)26;/h3-10H,1-2H3,(H,20,21)(H,23,24)(H,25,26);1H |
| InChIKey | ZVXOOQYDEJFLBC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|