C16H23N4O2+ — CID 7719246
2-[[3-carboxy-6-(dimethylamino)quinolin-4-yl]amino]ethyl-dimethylazanium (PubChem CID 7719246) has the molecular formula C16H23N4O2+ and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-[[3-carboxy-6-(dimethylamino)quinolin-4-yl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[3-carboxy-6-(dimethylamino)quinolin-4-yl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7719246 |
| Molecular Formula | C16H23N4O2+ |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[[3-carboxy-6-(dimethylamino)quinolin-4-yl]amino]ethyl-dimethylazanium |
| SMILES | CN(C)c1ccc2ncc(C(=O)O)c(NCC[NH+](C)C)c2c1 |
| InChI | InChI=1S/C16H22N4O2/c1-19(2)8-7-17-15-12-9-11(20(3)4)5-6-14(12)18-10-13(15)16(21)22/h5-6,9-10H,7-8H2,1-4H3,(H,17,18)(H,21,22)/p+1 |
| InChIKey | CWCUMEFGPPHUFS-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |