C18H22ClN3O3 — CID 21283433
6-chloro-4-[[2-(dipropylamino)-2-oxoethyl]amino]quinoline-3-carboxylic acid (PubChem CID 21283433) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is 6-chloro-4-[[2-(dipropylamino)-2-oxoethyl]amino]quinoline-3-carboxylic acid.
| Compound Name | 6-chloro-4-[[2-(dipropylamino)-2-oxoethyl]amino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 21283433 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 6-chloro-4-[[2-(dipropylamino)-2-oxoethyl]amino]quinoline-3-carboxylic acid |
| SMILES | CCCN(CCC)C(=O)CNc1c(C(=O)O)cnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H22ClN3O3/c1-3-7-22(8-4-2)16(23)11-21-17-13-9-12(19)5-6-15(13)20-10-14(17)18(24)25/h5-6,9-10H,3-4,7-8,11H2,1-2H3,(H,20,21)(H,24,25) |
| InChIKey | KYZGTASGVMVYHZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |