C23H24ClN3O3 — CID 53333938
[6-chloro-4-[(3-ethoxyphenyl)methylamino]quinolin-3-yl]-morpholin-4-ylmethanone (PubChem CID 53333938) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is [6-chloro-4-[(3-ethoxyphenyl)methylamino]quinolin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-chloro-4-[(3-ethoxyphenyl)methylamino]quinolin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53333938 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [6-chloro-4-[(3-ethoxyphenyl)methylamino]quinolin-3-yl]-morpholin-4-ylmethanone |
| SMILES | CCOc1cccc(CNc2c(C(=O)N3CCOCC3)cnc3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-2-30-18-5-3-4-16(12-18)14-26-22-19-13-17(24)6-7-21(19)25-15-20(22)23(28)27-8-10-29-11-9-27/h3-7,12-13,15H,2,8-11,14H2,1H3,(H,25,26) |
| InChIKey | ZADFKTXXGLEGDJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |