C18H17Cl2N3O2 — CID 20982489
6-chloro-4-[4-(dimethylamino)anilino]quinoline-3-carboxylic acid;hydrochloride (PubChem CID 20982489) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 6-chloro-4-[4-(dimethylamino)anilino]quinoline-3-carboxylic acid;hydrochloride.
| Compound Name | 6-chloro-4-[4-(dimethylamino)anilino]quinoline-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 20982489 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 6-chloro-4-[4-(dimethylamino)anilino]quinoline-3-carboxylic acid;hydrochloride |
| SMILES | CN(C)c1ccc(Nc2c(C(=O)O)cnc3ccc(Cl)cc23)cc1.Cl |
| InChI | InChI=1S/C18H16ClN3O2.ClH/c1-22(2)13-6-4-12(5-7-13)21-17-14-9-11(19)3-8-16(14)20-10-15(17)18(23)24;/h3-10H,1-2H3,(H,20,21)(H,23,24);1H |
| InChIKey | JQIOXBBEEOGIEZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|