C22H21ClN3O2- — CID 7453555
6-chloro-4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3-carboxylate (PubChem CID 7453555) has the molecular formula C22H21ClN3O2- and a molecular weight of 394.88 g/mol. Its IUPAC name is 6-chloro-4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3-carboxylate.
| Compound Name | 6-chloro-4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7453555 |
| Molecular Formula | C22H21ClN3O2- |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 6-chloro-4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3-carboxylate |
| SMILES | CC1CCN(c2ccc(Nc3c(C(=O)[O-])cnc4ccc(Cl)cc34)cc2)CC1 |
| InChI | InChI=1S/C22H22ClN3O2/c1-14-8-10-26(11-9-14)17-5-3-16(4-6-17)25-21-18-12-15(23)2-7-20(18)24-13-19(21)22(27)28/h2-7,12-14H,8-11H2,1H3,(H,24,25)(H,27,28)/p-1 |
| InChIKey | AHVJRMYAMNXJEA-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|