C13H16NO2- — CID 7023615
4-(4-methylpiperidin-1-yl)benzoate (PubChem CID 7023615) has the molecular formula C13H16NO2- and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)benzoate.
| Compound Name | 4-(4-methylpiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7023615 |
| Molecular Formula | C13H16NO2- |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)benzoate |
| SMILES | CC1CCN(c2ccc(C(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C13H17NO2/c1-10-6-8-14(9-7-10)12-4-2-11(3-5-12)13(15)16/h2-5,10H,6-9H2,1H3,(H,15,16)/p-1 |
| InChIKey | ZIFMYTNXBNDWLU-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |