C10H10NO2S- — CID 140714322
4-(1,3-thiazolidin-3-yl)benzoate (PubChem CID 140714322) has the molecular formula C10H10NO2S- and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(1,3-thiazolidin-3-yl)benzoate.
| Compound Name | 4-(1,3-thiazolidin-3-yl)benzoate |
|---|---|
| PubChem CID | 140714322 |
| Molecular Formula | C10H10NO2S- |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 4-(1,3-thiazolidin-3-yl)benzoate |
| SMILES | O=C([O-])c1ccc(N2CCSC2)cc1 |
| InChI | InChI=1S/C10H11NO2S/c12-10(13)8-1-3-9(4-2-8)11-5-6-14-7-11/h1-4H,5-7H2,(H,12,13)/p-1 |
| InChIKey | FZEHGDHVYUZYSK-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |