C24H23N5O4S — CID 167141402
methyl [4-[[4-[[4-(1,3-thiazolidin-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]methyl carbonate (PubChem CID 167141402) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is methyl [4-[[4-[[4-(1,3-thiazolidin-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]methyl carbonate.
| Compound Name | methyl [4-[[4-[[4-(1,3-thiazolidin-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]methyl carbonate |
|---|---|
| PubChem CID | 167141402 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | methyl [4-[[4-[[4-(1,3-thiazolidin-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]methyl carbonate |
| SMILES | COC(=O)OCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(N4CCSC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H23N5O4S/c1-31-24(30)33-17-32-23-12-8-21(9-13-23)28-26-19-4-2-18(3-5-19)25-27-20-6-10-22(11-7-20)29-14-15-34-16-29/h2-13H,14-17H2,1H3/b27-25+,28-26+ |
| InChIKey | SHFZQQZJBKCSFT-NBHCHVEOSA-N |
| XLogP | 7.15 |
| TPSA | 97.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|