C21H18ClN3 — CID 177371668
1-N-(2-chloroacridin-9-yl)-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 177371668) has the molecular formula C21H18ClN3 and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-N-(2-chloroacridin-9-yl)-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-(2-chloroacridin-9-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 177371668 |
| Molecular Formula | C21H18ClN3 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-N-(2-chloroacridin-9-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2c3ccccc3nc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C21H18ClN3/c1-25(2)16-10-8-15(9-11-16)23-21-17-5-3-4-6-19(17)24-20-12-7-14(22)13-18(20)21/h3-13H,1-2H3,(H,23,24) |
| InChIKey | IXQPLVCAAGRTJC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|