C31H31ClN4 — CID 90736287
3-chloro-N-[[3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]phenyl]methyl]acridin-9-amine (PubChem CID 90736287) has the molecular formula C31H31ClN4 and a molecular weight of 495.07 g/mol. Its IUPAC name is 3-chloro-N-[[3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]phenyl]methyl]acridin-9-amine.
| Compound Name | 3-chloro-N-[[3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]phenyl]methyl]acridin-9-amine |
|---|---|
| PubChem CID | 90736287 |
| Molecular Formula | C31H31ClN4 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 3-chloro-N-[[3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]phenyl]methyl]acridin-9-amine |
| SMILES | CN(Cc1ccc(N(C)C)cc1)Cc1cccc(CNc2c3ccccc3nc3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C31H31ClN4/c1-35(2)26-14-11-22(12-15-26)20-36(3)21-24-8-6-7-23(17-24)19-33-31-27-9-4-5-10-29(27)34-30-18-25(32)13-16-28(30)31/h4-18H,19-21H2,1-3H3,(H,33,34) |
| InChIKey | XDXZGSLORVVFDZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|