C14H17ClN2O4 — CID 20982484
4-(2-hydroxypropylamino)-6-methoxyquinoline-3-carboxylic acid;hydrochloride (PubChem CID 20982484) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is 4-(2-hydroxypropylamino)-6-methoxyquinoline-3-carboxylic acid;hydrochloride.
| Compound Name | 4-(2-hydroxypropylamino)-6-methoxyquinoline-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 20982484 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-(2-hydroxypropylamino)-6-methoxyquinoline-3-carboxylic acid;hydrochloride |
| SMILES | COc1ccc2ncc(C(=O)O)c(NCC(C)O)c2c1.Cl |
| InChI | InChI=1S/C14H16N2O4.ClH/c1-8(17)6-16-13-10-5-9(20-2)3-4-12(10)15-7-11(13)14(18)19;/h3-5,7-8,17H,6H2,1-2H3,(H,15,16)(H,18,19);1H |
| InChIKey | VFSLVSWZZQWAHA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |