C42H38N2O6+2 — CID 132532187
2-[14-(2-carboxyphenyl)-3,10-bis(diethylamino)chromeno[2,3-b]xanthene-5,12-diium-7-yl]benzoic acid (PubChem CID 132532187) has the molecular formula C42H38N2O6+2 and a molecular weight of 666.77 g/mol. Its IUPAC name is 2-[14-(2-carboxyphenyl)-3,10-bis(diethylamino)chromeno[2,3-b]xanthene-5,12-diium-7-yl]benzoic acid.
| Compound Name | 2-[14-(2-carboxyphenyl)-3,10-bis(diethylamino)chromeno[2,3-b]xanthene-5,12-diium-7-yl]benzoic acid |
|---|---|
| PubChem CID | 132532187 |
| Molecular Formula | C42H38N2O6+2 |
| Molecular Weight | 666.77 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 2-[14-(2-carboxyphenyl)-3,10-bis(diethylamino)chromeno[2,3-b]xanthene-5,12-diium-7-yl]benzoic acid |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)O)c3cc4[o+]c5cc(N(CC)CC)ccc5c(-c5ccccc5C(=O)O)c4cc3[o+]c2c1 |
| InChI | InChI=1S/C42H36N2O6/c1-5-43(6-2)25-17-19-31-35(21-25)49-37-23-34-38(24-33(37)39(31)27-13-9-11-15-29(27)41(45)46)50-36-22-26(44(7-3)8-4)18-20-32(36)40(34)28-14-10-12-16-30(28)42(47)48/h9-24H,5-8H2,1-4H3/p+2 |
| InChIKey | JAFWJHGEALAROE-UHFFFAOYSA-P |
| XLogP | 10.47 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.77 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|