C32H33N2O5+ — CID 123403488
[7-(2-carboxyphenyl)-10-(diethylamino)-2-ethyl-6-oxochromeno[4,3-b]chromen-3-ylidene]-ethyl-methylazanium (PubChem CID 123403488) has the molecular formula C32H33N2O5+ and a molecular weight of 525.63 g/mol. Its IUPAC name is [7-(2-carboxyphenyl)-10-(diethylamino)-2-ethyl-6-oxochromeno[4,3-b]chromen-3-ylidene]-ethyl-methylazanium.
| Compound Name | [7-(2-carboxyphenyl)-10-(diethylamino)-2-ethyl-6-oxochromeno[4,3-b]chromen-3-ylidene]-ethyl-methylazanium |
|---|---|
| PubChem CID | 123403488 |
| Molecular Formula | C32H33N2O5+ |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | [7-(2-carboxyphenyl)-10-(diethylamino)-2-ethyl-6-oxochromeno[4,3-b]chromen-3-ylidene]-ethyl-methylazanium |
| SMILES | CCc1cc2c(c/c1=[N+](\C)CC)oc(=O)c1c(-c3ccccc3C(=O)O)c3ccc(N(CC)CC)cc3oc12 |
| InChI | InChI=1S/C32H32N2O5/c1-6-19-16-24-27(18-25(19)33(5)7-2)39-32(37)29-28(21-12-10-11-13-22(21)31(35)36)23-15-14-20(34(8-3)9-4)17-26(23)38-30(24)29/h10-18H,6-9H2,1-5H3/p+1 |
| InChIKey | UVJSKAIZHOZYMN-UHFFFAOYSA-O |
| XLogP | 5.89 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|