C29H25N2O6+ — CID 123586541
[7-(2-carboxyphenyl)-10-morpholin-4-yl-6-oxochromeno[3,2-c]chromen-3-ylidene]-dimethylazanium (PubChem CID 123586541) has the molecular formula C29H25N2O6+ and a molecular weight of 497.53 g/mol. Its IUPAC name is [7-(2-carboxyphenyl)-10-morpholin-4-yl-6-oxochromeno[3,2-c]chromen-3-ylidene]-dimethylazanium.
| Compound Name | [7-(2-carboxyphenyl)-10-morpholin-4-yl-6-oxochromeno[3,2-c]chromen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 123586541 |
| Molecular Formula | C29H25N2O6+ |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [7-(2-carboxyphenyl)-10-morpholin-4-yl-6-oxochromeno[3,2-c]chromen-3-ylidene]-dimethylazanium |
| SMILES | C[N+](C)=c1ccc2c(c1)oc(=O)c1c(-c3ccccc3C(=O)O)c3ccc(N4CCOCC4)cc3oc12 |
| InChI | InChI=1S/C29H24N2O6/c1-30(2)17-7-10-22-24(15-17)37-29(34)26-25(19-5-3-4-6-20(19)28(32)33)21-9-8-18(16-23(21)36-27(22)26)31-11-13-35-14-12-31/h3-10,15-16H,11-14H2,1-2H3/p+1 |
| InChIKey | VIQSITRDIYNWGN-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|