C14H13NO5 — CID 3469110
7-morpholin-4-yl-2-oxochromene-3-carboxylic acid (PubChem CID 3469110) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 7-morpholin-4-yl-2-oxochromene-3-carboxylic acid.
| Compound Name | 7-morpholin-4-yl-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 3469110 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 7-morpholin-4-yl-2-oxochromene-3-carboxylic acid |
| SMILES | O=C(O)c1cc2ccc(N3CCOCC3)cc2oc1=O |
| InChI | InChI=1S/C14H13NO5/c16-13(17)11-7-9-1-2-10(8-12(9)20-14(11)18)15-3-5-19-6-4-15/h1-2,7-8H,3-6H2,(H,16,17) |
| InChIKey | KCTFUVGCNPZNQR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|