C15H15NO5 — CID 58939664
4-methyl-7-morpholin-4-yl-2-oxochromene-3-carboxylic acid (PubChem CID 58939664) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-methyl-7-morpholin-4-yl-2-oxochromene-3-carboxylic acid.
| Compound Name | 4-methyl-7-morpholin-4-yl-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58939664 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-methyl-7-morpholin-4-yl-2-oxochromene-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(=O)oc2cc(N3CCOCC3)ccc12 |
| InChI | InChI=1S/C15H15NO5/c1-9-11-3-2-10(16-4-6-20-7-5-16)8-12(11)21-15(19)13(9)14(17)18/h2-3,8H,4-7H2,1H3,(H,17,18) |
| InChIKey | HVSZDUPIOOOCKP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|