C19H20N2O5 — CID 135134930
(2-oxopyrrolidin-1-yl) 2-[7-(azetidin-1-yl)-4-methyl-2-oxochromen-3-yl]acetate (PubChem CID 135134930) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2-oxopyrrolidin-1-yl) 2-[7-(azetidin-1-yl)-4-methyl-2-oxochromen-3-yl]acetate.
| Compound Name | (2-oxopyrrolidin-1-yl) 2-[7-(azetidin-1-yl)-4-methyl-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 135134930 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2-oxopyrrolidin-1-yl) 2-[7-(azetidin-1-yl)-4-methyl-2-oxochromen-3-yl]acetate |
| SMILES | Cc1c(CC(=O)ON2CCCC2=O)c(=O)oc2cc(N3CCC3)ccc12 |
| InChI | InChI=1S/C19H20N2O5/c1-12-14-6-5-13(20-7-3-8-20)10-16(14)25-19(24)15(12)11-18(23)26-21-9-2-4-17(21)22/h5-6,10H,2-4,7-9,11H2,1H3 |
| InChIKey | VUSZGXFGDYRZMX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|