C17H12N2O7 — CID 169352986
(2,5-dioxopyrrolidin-1-yl) 2-(7-isocyanato-4-methyl-2-oxochromen-3-yl)acetate (PubChem CID 169352986) has the molecular formula C17H12N2O7 and a molecular weight of 356.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(7-isocyanato-4-methyl-2-oxochromen-3-yl)acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(7-isocyanato-4-methyl-2-oxochromen-3-yl)acetate |
|---|---|
| PubChem CID | 169352986 |
| Molecular Formula | C17H12N2O7 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(7-isocyanato-4-methyl-2-oxochromen-3-yl)acetate |
| SMILES | Cc1c(CC(=O)ON2C(=O)CCC2=O)c(=O)oc2cc(N=C=O)ccc12 |
| InChI | InChI=1S/C17H12N2O7/c1-9-11-3-2-10(18-8-20)6-13(11)25-17(24)12(9)7-16(23)26-19-14(21)4-5-15(19)22/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | UXELRAXUTDTOEU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 123.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|