C24H16BrNO7 — CID 122576690
(2,5-dioxopyrrolidin-1-yl) 2-[3-(4-bromophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetate (PubChem CID 122576690) has the molecular formula C24H16BrNO7 and a molecular weight of 510.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[3-(4-bromophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-(4-bromophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetate |
|---|---|
| PubChem CID | 122576690 |
| Molecular Formula | C24H16BrNO7 |
| Molecular Weight | 510.30 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-(4-bromophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]acetate |
| SMILES | Cc1c(CC(=O)ON2C(=O)CCC2=O)c(=O)oc2cc3occ(-c4ccc(Br)cc4)c3cc12 |
| InChI | InChI=1S/C24H16BrNO7/c1-12-15-8-17-18(13-2-4-14(25)5-3-13)11-31-19(17)10-20(15)32-24(30)16(12)9-23(29)33-26-21(27)6-7-22(26)28/h2-5,8,10-11H,6-7,9H2,1H3 |
| InChIKey | WHXCMAQXPWBENN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 107.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|