C19H15N3O7 — CID 168521162
(2,5-dioxopyrrolidin-1-yl) 2-[7-[(2-cyanoacetyl)amino]-4-methyl-2-oxochromen-3-yl]acetate (PubChem CID 168521162) has the molecular formula C19H15N3O7 and a molecular weight of 397.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[7-[(2-cyanoacetyl)amino]-4-methyl-2-oxochromen-3-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[7-[(2-cyanoacetyl)amino]-4-methyl-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 168521162 |
| Molecular Formula | C19H15N3O7 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[7-[(2-cyanoacetyl)amino]-4-methyl-2-oxochromen-3-yl]acetate |
| SMILES | Cc1c(CC(=O)ON2C(=O)CCC2=O)c(=O)oc2cc(NC(=O)CC#N)ccc12 |
| InChI | InChI=1S/C19H15N3O7/c1-10-12-3-2-11(21-15(23)6-7-20)8-14(12)28-19(27)13(10)9-18(26)29-22-16(24)4-5-17(22)25/h2-3,8H,4-6,9H2,1H3,(H,21,23) |
| InChIKey | VWDGKTJPDNXOPB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|