C21H17NO6 — CID 167922839
2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-(4-oxo-2,3-dihydrochromen-6-yl)acetamide (PubChem CID 167922839) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-(4-oxo-2,3-dihydrochromen-6-yl)acetamide.
| Compound Name | 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-(4-oxo-2,3-dihydrochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 167922839 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-(4-oxo-2,3-dihydrochromen-6-yl)acetamide |
| SMILES | Cc1c(CC(=O)Nc2ccc3c(c2)C(=O)CCO3)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C21H17NO6/c1-11-14-4-3-13(23)9-19(14)28-21(26)15(11)10-20(25)22-12-2-5-18-16(8-12)17(24)6-7-27-18/h2-5,8-9,23H,6-7,10H2,1H3,(H,22,25) |
| InChIKey | UUIOLJPDFOLHGS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|