C23H21NO5 — CID 166318510
2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-oxocyclopentyl)phenyl]acetamide (PubChem CID 166318510) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-oxocyclopentyl)phenyl]acetamide.
| Compound Name | 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-oxocyclopentyl)phenyl]acetamide |
|---|---|
| PubChem CID | 166318510 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-[4-(3-oxocyclopentyl)phenyl]acetamide |
| SMILES | Cc1c(CC(=O)Nc2ccc(C3CCC(=O)C3)cc2)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C23H21NO5/c1-13-19-9-8-18(26)11-21(19)29-23(28)20(13)12-22(27)24-16-5-2-14(3-6-16)15-4-7-17(25)10-15/h2-3,5-6,8-9,11,15,26H,4,7,10,12H2,1H3,(H,24,27) |
| InChIKey | MCYBTKGKKOVIEN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|