C24H27N2O4+ — CID 7597803
N-(1-benzylpiperidin-1-ium-4-yl)-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 7597803) has the molecular formula C24H27N2O4+ and a molecular weight of 407.49 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 7597803 |
| Molecular Formula | C24H27N2O4+ |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-(7-hydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | Cc1c(CC(=O)NC2CC[NH+](Cc3ccccc3)CC2)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C24H26N2O4/c1-16-20-8-7-19(27)13-22(20)30-24(29)21(16)14-23(28)25-18-9-11-26(12-10-18)15-17-5-3-2-4-6-17/h2-8,13,18,27H,9-12,14-15H2,1H3,(H,25,28)/p+1 |
| InChIKey | QJPDIUPMSYVJNB-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|