C15H16ClNO4 — CID 152691120
ethyl N-[3-(2-chloroethyl)-4-methyl-2-oxochromen-7-yl]carbamate (PubChem CID 152691120) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is ethyl N-[3-(2-chloroethyl)-4-methyl-2-oxochromen-7-yl]carbamate.
| Compound Name | ethyl N-[3-(2-chloroethyl)-4-methyl-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 152691120 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | ethyl N-[3-(2-chloroethyl)-4-methyl-2-oxochromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(C)c(CCCl)c(=O)oc2c1 |
| InChI | InChI=1S/C15H16ClNO4/c1-3-20-15(19)17-10-4-5-11-9(2)12(6-7-16)14(18)21-13(11)8-10/h4-5,8H,3,6-7H2,1-2H3,(H,17,19) |
| InChIKey | ZPOWDNBVUVAZBI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|