C22H19N5O2 — CID 162405764
7-(azetidin-1-yl)-4-methyl-3-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]chromen-2-one (PubChem CID 162405764) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 7-(azetidin-1-yl)-4-methyl-3-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]chromen-2-one.
| Compound Name | 7-(azetidin-1-yl)-4-methyl-3-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 162405764 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 7-(azetidin-1-yl)-4-methyl-3-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]chromen-2-one |
| SMILES | Cc1nnc(-c2cccc(-c3c(C)c4ccc(N5CCC5)cc4oc3=O)c2)nn1 |
| InChI | InChI=1S/C22H19N5O2/c1-13-18-8-7-17(27-9-4-10-27)12-19(18)29-22(28)20(13)15-5-3-6-16(11-15)21-25-23-14(2)24-26-21/h3,5-8,11-12H,4,9-10H2,1-2H3 |
| InChIKey | RZGNTUWYDQNTHB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|