C17H14N2O4S — CID 162687736
2-[7-(azetidin-1-yl)-2-oxochromen-3-yl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 162687736) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-[7-(azetidin-1-yl)-2-oxochromen-3-yl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[7-(azetidin-1-yl)-2-oxochromen-3-yl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 162687736 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[7-(azetidin-1-yl)-2-oxochromen-3-yl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2cc3ccc(N4CCC4)cc3oc2=O)sc1C(=O)O |
| InChI | InChI=1S/C17H14N2O4S/c1-9-14(16(20)21)24-15(18-9)12-7-10-3-4-11(19-5-2-6-19)8-13(10)23-17(12)22/h3-4,7-8H,2,5-6H2,1H3,(H,20,21) |
| InChIKey | WHTIRPYWNUHRCJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|