C17H16N2O7S2 — CID 162712739
4-methyl-2-[2-oxo-7-(3-sulfopropylamino)chromen-3-yl]-1,3-thiazole-5-carboxylic acid (PubChem CID 162712739) has the molecular formula C17H16N2O7S2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-methyl-2-[2-oxo-7-(3-sulfopropylamino)chromen-3-yl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-methyl-2-[2-oxo-7-(3-sulfopropylamino)chromen-3-yl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 162712739 |
| Molecular Formula | C17H16N2O7S2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 4-methyl-2-[2-oxo-7-(3-sulfopropylamino)chromen-3-yl]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2cc3ccc(NCCCS(=O)(=O)O)cc3oc2=O)sc1C(=O)O |
| InChI | InChI=1S/C17H16N2O7S2/c1-9-14(16(20)21)27-15(19-9)12-7-10-3-4-11(8-13(10)26-17(12)22)18-5-2-6-28(23,24)25/h3-4,7-8,18H,2,5-6H2,1H3,(H,20,21)(H,23,24,25) |
| InChIKey | UNNOTEQBQJVMNW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|