C22H20N2O7S2 — CID 138560308
6-[[3-(1,3-benzothiazol-2-yl)-2-oxo-6-sulfochromen-7-yl]amino]hexanoic acid (PubChem CID 138560308) has the molecular formula C22H20N2O7S2 and a molecular weight of 488.54 g/mol. Its IUPAC name is 6-[[3-(1,3-benzothiazol-2-yl)-2-oxo-6-sulfochromen-7-yl]amino]hexanoic acid.
| Compound Name | 6-[[3-(1,3-benzothiazol-2-yl)-2-oxo-6-sulfochromen-7-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 138560308 |
| Molecular Formula | C22H20N2O7S2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 6-[[3-(1,3-benzothiazol-2-yl)-2-oxo-6-sulfochromen-7-yl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNc1cc2oc(=O)c(-c3nc4ccccc4s3)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C22H20N2O7S2/c25-20(26)8-2-1-5-9-23-16-12-17-13(11-19(16)33(28,29)30)10-14(22(27)31-17)21-24-15-6-3-4-7-18(15)32-21/h3-4,6-7,10-12,23H,1-2,5,8-9H2,(H,25,26)(H,28,29,30) |
| InChIKey | SOSNASPSAQIVCR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|