C24H24N2O7S2 — CID 155086976
[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]sulfamic acid (PubChem CID 155086976) has the molecular formula C24H24N2O7S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]sulfamic acid.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]sulfamic acid |
|---|---|
| PubChem CID | 155086976 |
| Molecular Formula | C24H24N2O7S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]sulfamic acid |
| SMILES | CC(C)(C)OC(=O)CCCN(c1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1)S(=O)(=O)O |
| InChI | InChI=1S/C24H24N2O7S2/c1-24(2,3)33-21(27)9-6-12-26(35(29,30)31)16-11-10-15-13-17(23(28)32-19(15)14-16)22-25-18-7-4-5-8-20(18)34-22/h4-5,7-8,10-11,13-14H,6,9,12H2,1-3H3,(H,29,30,31) |
| InChIKey | KKIFGOONKVBBHH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|